Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] == * direction: ** left-to-right == Reaction formula == * 1 3Prime-OH-Termin...")
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] ==
+
== Metabolite GTP ==
* direction:
+
* common-name:
** left-to-right
+
** gtp
== Reaction formula ==
+
* smiles:
* 1 [[3Prime-OH-Terminated-RNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-RNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RNA-Holder]][c]
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ03634]]
+
** xkmlyualxhknft-uuokfmhzsa-j
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 519.151
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
== External links  ==
+
* [[FE2GTPabc]]
{{#set: direction=left-to-right}}
+
* [[GTCY]]
{{#set: nb gene associated=1}}
+
* [[GTP-CYCLOHYDRO-I-RXN]]
{{#set: nb pathway associated=0}}
+
* [[GTP-CYCLOHYDRO-II-RXN]]
{{#set: reconstruction category=annotation}}
+
* [[GTPPYPHOSKIN-RXN]]
{{#set: reconstruction tool=pathwaytools}}
+
* [[GTUP]]
{{#set: reconstruction comment=n.a}}
+
* [[GUANYLCYC-RXN]]
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
 +
* [[NTDP]]
 +
* [[RXN-12502]]
 +
* [[RXN-12504]]
 +
* [[RXN-14140]]
 +
* [[RXN-14201]]
 +
* [[RXN-15713]]
 +
* [[RXN-17921]]
 +
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5462]]
 +
* [[RXN0-746]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gtp}}
 +
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 +
{{#set: molecular-weight=519.151}}

Latest revision as of 11:15, 18 March 2021