Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17442 == * transcription-direction: ** positive * right-end-position: ** 319389 * left-end-position: ** 304921 * centisome-position: ** 45.085915...")
 
(Created page with "Category:metabolite == Metabolite GTP == * common-name: ** gtp * smiles: ** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17442 ==
+
== Metabolite GTP ==
* transcription-direction:
+
* common-name:
** positive
+
** gtp
* right-end-position:
+
* smiles:
** 319389
+
** c(op([o-])(=o)op(=o)([o-])op([o-])(=o)[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
* left-end-position:
+
* inchi-key:
** 304921
+
** xkmlyualxhknft-uuokfmhzsa-j
* centisome-position:
+
* molecular-weight:
** 45.085915   
+
** 519.151
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
== Reaction(s) associated ==
+
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
* [[3.1.26.5-RXN]]
+
* [[FE2GTPabc]]
** Category: [[annotation]]
+
* [[GTCY]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GTP-CYCLOHYDRO-I-RXN]]
* [[RXN0-6480]]
+
* [[GTP-CYCLOHYDRO-II-RXN]]
** Category: [[annotation]]
+
* [[GTPPYPHOSKIN-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GTUP]]
== Pathway(s) associated ==
+
* [[GUANYLCYC-RXN]]
* [[PWY0-1479]]
+
* [[MRNA-GUANYLYLTRANSFERASE-RXN]]
** '''4''' reactions found over '''10''' reactions in the full pathway
+
* [[NTDP]]
{{#set: transcription-direction=positive}}
+
* [[RXN-12502]]
{{#set: right-end-position=319389}}
+
* [[RXN-12504]]
{{#set: left-end-position=304921}}
+
* [[RXN-14140]]
{{#set: centisome-position=45.085915    }}
+
* [[RXN-14201]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[RXN-15713]]
{{#set: nb reaction associated=2}}
+
* [[RXN-17921]]
{{#set: nb pathway associated=1}}
+
* [[RXN-8340]]
 +
* [[RXN-8988]]
 +
* [[RXN0-5462]]
 +
* [[RXN0-746]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
* [[URKI-RXN]]
 +
</div>
 +
== Reaction(s) known to produce the compound ==
 +
* [[3.6.1.17-RXN]]
 +
* [[ATGD]]
 +
* [[GDPKIN-RXN]]
 +
* [[GTPOP]]
 +
* [[RXN-14117]]
 +
* [[RXN0-6427]]
 +
* [[SUCCINATE--COA-LIGASE-GDP-FORMING-RXN]]
 +
* [[SUCL_LPAREN_gdp_RPAREN_m]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=gtp}}
 +
{{#set: inchi-key=inchikey=xkmlyualxhknft-uuokfmhzsa-j}}
 +
{{#set: molecular-weight=519.151}}

Latest revision as of 11:15, 18 March 2021