Difference between revisions of "GTP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] == * direction: ** left-to-right == Reaction formula == * 1 3Prime-OH-Termin...")
(Created page with "Category:metabolite == Metabolite URIDINE == * common-name: ** uridine * smiles: ** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)) * inchi-key: ** drtqhjpvmgbucf-xvfcmesisa-n *...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17927 RXN-17927] ==
+
== Metabolite URIDINE ==
* direction:
+
* common-name:
** left-to-right
+
** uridine
== Reaction formula ==
+
* smiles:
* 1 [[3Prime-OH-Terminated-RNAs]][c] '''+''' 1 [[A-5-prime-PP-5-prime-RNA]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[RNA-Holder]][c]
+
** c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ03634]]
+
** drtqhjpvmgbucf-xvfcmesisa-n
** Category: [[annotation]]
+
* molecular-weight:
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 244.204
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[AUPT]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DATUP]]
== External links  ==
+
* [[DCTUP]]
{{#set: direction=left-to-right}}
+
* [[DGTUP]]
{{#set: nb gene associated=1}}
+
* [[DTTUP]]
{{#set: nb pathway associated=0}}
+
* [[DUTUP]]
{{#set: reconstruction category=annotation}}
+
* [[GTUP]]
{{#set: reconstruction tool=pathwaytools}}
+
* [[ITUP]]
{{#set: reconstruction comment=n.a}}
+
* [[URIDINE-NUCLEOSIDASE-RXN]]
{{#set: reconstruction source=saccharina_japonica_genome}}
+
* [[URIDINEKIN-RXN]]
 +
* [[URKI-RXN]]
 +
* [[URPHOS-RXN]]
 +
* [[UTUP]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[CYTIDEAM2-RXN]]
 +
* [[RXN-14025]]
 +
* [[UMPP]]
 +
* [[URPHOS-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=uridine}}
 +
{{#set: inchi-key=inchikey=drtqhjpvmgbucf-xvfcmesisa-n}}
 +
{{#set: molecular-weight=244.204}}

Revision as of 20:34, 18 December 2020

Metabolite URIDINE

  • common-name:
    • uridine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
  • inchi-key:
    • drtqhjpvmgbucf-xvfcmesisa-n
  • molecular-weight:
    • 244.204

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality