Difference between revisions of "GTP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15839 == * common-name: ** δ-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=cc(=cc=2c)o)))c)c)c * inchi-key: ** o...") |
(Created page with "Category:metabolite == Metabolite His-tRNA-2-O-MeAdenosine4 == * common-name: ** a 2'-o-methyladenosine4 in trnahis == Reaction(s) known to consume the compound == == Reac...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite His-tRNA-2-O-MeAdenosine4 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 2'-o-methyladenosine4 in trnahis |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12479]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 2'-o-methyladenosine4 in trnahis}} |
| − | |||
| − | |||
Revision as of 15:28, 5 January 2021
Contents
Metabolite His-tRNA-2-O-MeAdenosine4
- common-name:
- a 2'-o-methyladenosine4 in trnahis
