Difference between revisions of "GUANIDOACETIC ACID"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INOSINE == * common-name: ** inosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key: ** ugqmrvrmyyaskq-kqynxxcusa...") |
(Created page with "Category:metabolite == Metabolite GUANIDOACETIC_ACID == * common-name: ** guanidinoacetate * smiles: ** c(nc(n)=[n+])c([o-])=o * inchi-key: ** bpmfzumjyqtvii-uhfffaoysa-n...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GUANIDOACETIC_ACID == |
* common-name: | * common-name: | ||
− | ** | + | ** guanidinoacetate |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(nc(n)=[n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bpmfzumjyqtvii-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 117.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GUANIDINOACETATE-N-METHYLTRANSFERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=guanidinoacetate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bpmfzumjyqtvii-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=117.107}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite GUANIDOACETIC_ACID
- common-name:
- guanidinoacetate
- smiles:
- c(nc(n)=[n+])c([o-])=o
- inchi-key:
- bpmfzumjyqtvii-uhfffaoysa-n
- molecular-weight:
- 117.107