Difference between revisions of "GUANIDOACETIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HOMOGENTISATE == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)cc([o-])=o)o) * inchi-key: ** igmnyecmumzddf-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite CPD-18312 == * common-name: ** n-3-fumaramoyl-l-2,3-diaminopropanoate * smiles: ** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o * inchi-key: ** ujv...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HOMOGENTISATE ==
+
== Metabolite CPD-18312 ==
 
* common-name:
 
* common-name:
** homogentisate
+
** n-3-fumaramoyl-l-2,3-diaminopropanoate
 
* smiles:
 
* smiles:
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
+
** c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
 
* inchi-key:
 
* inchi-key:
** igmnyecmumzddf-uhfffaoysa-m
+
** ujvdeptvvyupmx-qphdtyrisa-n
 
* molecular-weight:
 
* molecular-weight:
** 167.141
+
** 201.182
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14929]]
+
* [[RXN-16291]]
* [[RXN-2541]]
+
* [[RXN-16292]]
* [[RXN-2761]]
+
* [[RXN-16293]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[HPPD]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=homogentisate}}
+
{{#set: common-name=n-3-fumaramoyl-l-2,3-diaminopropanoate}}
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ujvdeptvvyupmx-qphdtyrisa-n}}
{{#set: molecular-weight=167.141}}
+
{{#set: molecular-weight=201.182}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-18312

  • common-name:
    • n-3-fumaramoyl-l-2,3-diaminopropanoate
  • smiles:
    • c([o-])(=o)c=cc(=o)ncc([n+])c(n)=o
  • inchi-key:
    • ujvdeptvvyupmx-qphdtyrisa-n
  • molecular-weight:
    • 201.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality