Difference between revisions of "GUANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.90-RXN 2.7.1.90-RXN] == * direction: ** reversible * common-name: ** diphosphate:fructose-6-p...")
(Created page with "Category:metabolite == Metabolite GUANINE == * common-name: ** guanine * smiles: ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) * inchi-key: ** uytpupdqbnuygx-uhfffaoysa-n * molecular-w...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.90-RXN 2.7.1.90-RXN] ==
+
== Metabolite GUANINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** diphosphate:fructose-6-phosphate 1-phosphotransferase
+
** guanine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.1.90 ec-2.7.1.90]
+
** c2(=nc1(=c(n=c(nc(=o)1)n)n2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[FRUCTOSE-6P]][c] '''+''' 1 [[PPI]][c] '''<=>''' 1 [[FRUCTOSE-16-DIPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
+
** uytpupdqbnuygx-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ16394]]
+
** 151.127
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3.6.3.37-RXN]]
−
== Pathway(s) ==
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
* [[PWY-1042]], glycolysis IV (plant cytosol): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1042 PWY-1042]
+
* [[GUANINE-DEAMINASE-RXN]]
−
** '''9''' reactions found over '''10''' reactions in the full pathway
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
== Reconstruction information  ==
+
* [[RXN0-5199]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== External links  ==
+
* [[3.6.3.37-RXN]]
−
* RHEA:
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13616 13616]
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
* LIGAND-RXN:
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R00764 R00764]
+
* [[RXN0-1321]]
−
* UNIPROT:
+
* [[RXN0-366]]
−
** [http://www.uniprot.org/uniprot/P21342 P21342]
+
* [[RXN0-5199]]
−
** [http://www.uniprot.org/uniprot/P29495 P29495]
+
== Reaction(s) of unknown directionality ==
−
** [http://www.uniprot.org/uniprot/O83146 O83146]
+
{{#set: common-name=guanine}}
−
** [http://www.uniprot.org/uniprot/O84210 O84210]
+
{{#set: inchi-key=inchikey=uytpupdqbnuygx-uhfffaoysa-n}}
−
** [http://www.uniprot.org/uniprot/P21343 P21343]
+
{{#set: molecular-weight=151.127}}
−
** [http://www.uniprot.org/uniprot/O51669 O51669]
 
−
** [http://www.uniprot.org/uniprot/Q27651 Q27651]
 
−
** [http://www.uniprot.org/uniprot/Q27659 Q27659]
 
−
** [http://www.uniprot.org/uniprot/O81437 O81437]
 
−
** [http://www.uniprot.org/uniprot/Q9STQ7 Q9STQ7]
 
−
** [http://www.uniprot.org/uniprot/Q41140 Q41140]
 
−
** [http://www.uniprot.org/uniprot/Q41141 Q41141]
 
−
** [http://www.uniprot.org/uniprot/Q9M076 Q9M076]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=diphosphate:fructose-6-phosphate 1-phosphotransferase}}
 
−
{{#set: ec-number=ec-2.7.1.90}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GUANINE

  • common-name:
    • guanine
  • smiles:
    • c2(=nc1(=c(n=c(nc(=o)1)n)n2))
  • inchi-key:
    • uytpupdqbnuygx-uhfffaoysa-n
  • molecular-weight:
    • 151.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GUANINE&oldid=138494"