Difference between revisions of "GUANINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MRNA-GUANYLYLTRANSFERASE-RXN MRNA-GUANYLYLTRANSFERASE-RXN] == * direction: ** left-to-right * commo...")
 
(Created page with "Category:metabolite == Metabolite GUANINE == * common-name: ** guanine * smiles: ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) * inchi-key: ** uytpupdqbnuygx-uhfffaoysa-n * molecular-w...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MRNA-GUANYLYLTRANSFERASE-RXN MRNA-GUANYLYLTRANSFERASE-RXN] ==
+
== Metabolite GUANINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** mrna guanylyltransferase
+
** guanine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.7.50 ec-2.7.7.50]
+
** c2(=nc1(=c(n=c(nc(=o)1)n)n2))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-8630]][c] '''+''' 1 [[GTP]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[G5-pppR-mRNAs]][c] '''+''' 1 [[PPI]][c]
+
** uytpupdqbnuygx-uhfffaoysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05217]]
+
** 151.127
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3.6.3.37-RXN]]
−
** Category: [[orthology]]
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GUANINE-DEAMINASE-RXN]]
−
== Pathway(s) ==
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
* [[PWY-7375]], mRNA capping I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7375 PWY-7375]
+
* [[RXN0-5199]]
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[3.6.3.37-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DEOXYGUANPHOSPHOR-RXN]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GUANPRIBOSYLTRAN-RXN]]
−
== External links  ==
+
* [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[RXN0-1321]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R03828 R03828]
+
* [[RXN0-366]]
−
* UNIPROT:
+
* [[RXN0-5199]]
−
** [http://www.uniprot.org/uniprot/P32094 P32094]
+
== Reaction(s) of unknown directionality ==
−
** [http://www.uniprot.org/uniprot/P33057 P33057]
+
{{#set: common-name=guanine}}
−
** [http://www.uniprot.org/uniprot/O60942 O60942]
+
{{#set: inchi-key=inchikey=uytpupdqbnuygx-uhfffaoysa-n}}
−
** [http://www.uniprot.org/uniprot/P04298 P04298]
+
{{#set: molecular-weight=151.127}}
−
** [http://www.uniprot.org/uniprot/P04318 P04318]
 
−
** [http://www.uniprot.org/uniprot/P25950 P25950]
 
−
** [http://www.uniprot.org/uniprot/P20979 P20979]
 
−
** [http://www.uniprot.org/uniprot/P11079 P11079]
 
−
** [http://www.uniprot.org/uniprot/Q01159 Q01159]
 
−
** [http://www.uniprot.org/uniprot/Q84424 Q84424]
 
−
** [http://www.uniprot.org/uniprot/Q98257 Q98257]
 
−
** [http://www.uniprot.org/uniprot/Q98268 Q98268]
 
−
** [http://www.uniprot.org/uniprot/P40997 P40997]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=mrna guanylyltransferase}}
 
−
{{#set: ec-number=ec-2.7.7.50}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GUANINE

  • common-name:
    • guanine
  • smiles:
    • c2(=nc1(=c(n=c(nc(=o)1)n)n2))
  • inchi-key:
    • uytpupdqbnuygx-uhfffaoysa-n
  • molecular-weight:
    • 151.127

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GUANINE&oldid=138494"