Difference between revisions of "GUANINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite OCTANOL == * common-name: ** 1-octanol * smiles: ** cccccccco * inchi-key: ** kbplfhhgfootca-uhfffaoysa-n * molecular-weight: ** 130.23 =...") |
(Created page with "Category:metabolite == Metabolite GUANINE == * common-name: ** guanine * smiles: ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) * inchi-key: ** uytpupdqbnuygx-uhfffaoysa-n * molecular-w...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GUANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** guanine |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(=nc1(=c(n=c(nc(=o)1)n)n2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uytpupdqbnuygx-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 151.127 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.6.3.37-RXN]] | ||
| + | * [[DEOXYGUANPHOSPHOR-RXN]] | ||
| + | * [[GUANINE-DEAMINASE-RXN]] | ||
| + | * [[GUANPRIBOSYLTRAN-RXN]] | ||
| + | * [[RXN0-5199]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.6.3.37-RXN]] |
| + | * [[DEOXYGUANPHOSPHOR-RXN]] | ||
| + | * [[GUANPRIBOSYLTRAN-RXN]] | ||
| + | * [[QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN]] | ||
| + | * [[RXN0-1321]] | ||
| + | * [[RXN0-366]] | ||
| + | * [[RXN0-5199]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=guanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uytpupdqbnuygx-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=151.127}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GUANINE
- common-name:
- guanine
- smiles:
- c2(=nc1(=c(n=c(nc(=o)1)n)n2))
- inchi-key:
- uytpupdqbnuygx-uhfffaoysa-n
- molecular-weight:
- 151.127
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.6.3.37-RXN
- DEOXYGUANPHOSPHOR-RXN
- GUANPRIBOSYLTRAN-RXN
- QUEUOSINE-TRNA-RIBOSYLTRANSFERASE-RXN
- RXN0-1321
- RXN0-366
- RXN0-5199
