Difference between revisions of "GUANOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GlcA-Gal-Gal-Xyl-Proteins == * common-name: ** a [protein]-3-o-(β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-...") |
(Created page with "Category:metabolite == Metabolite CPD-9894 == * common-name: ** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-9894 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,4-dihydroxy-5-all-trans-octaprenylbenzoate |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** ztgcmypriiaxfd-lhsbzcsksa-m | ||
| + | * molecular-weight: | ||
| + | ** 698.06 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9280]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,4-dihydroxy-5-all-trans-octaprenylbenzoate}} |
| + | {{#set: inchi-key=inchikey=ztgcmypriiaxfd-lhsbzcsksa-m}} | ||
| + | {{#set: molecular-weight=698.06}} | ||
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-9894
- common-name:
- 3,4-dihydroxy-5-all-trans-octaprenylbenzoate
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c)c)c
- inchi-key:
- ztgcmypriiaxfd-lhsbzcsksa-m
- molecular-weight:
- 698.06
