Difference between revisions of "GUANOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.107-RXN 4.2.1.107-RXN] == * direction: ** reversible * common-name: ** (24e)-3α,7&alpha...")
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=4.2.1.107-RXN 4.2.1.107-RXN] ==
+
== Metabolite GUANOSINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** (24e)-3α,7α,12α-trihydroxy-5β-cholest-24-enoyl-coa hydratase
+
** guanosine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/4.2.1.107 ec-4.2.1.107]
+
** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-7275]][c] '''<=>''' 1 [[CPD-7243]][c] '''+''' 1 [[WATER]][c]
+
** nyhbqmygnkiuif-uuokfmhzsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ03584]]
+
** 283.243
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN0-366]]
−
== Pathway(s) ==
+
* [[RXN0-5199]]
−
* [[PWY-6061]], bile acid biosynthesis, neutral pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6061 PWY-6061]
+
== Reaction(s) known to produce the compound ==
−
** '''3''' reactions found over '''29''' reactions in the full pathway
+
* [[RXN-7609]]
−
== Reconstruction information  ==
+
* [[RXN0-5199]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== External links  ==
+
{{#set: common-name=guanosine}}
−
* LIGAND-RXN:
+
{{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R04813 R04813]
+
{{#set: molecular-weight=283.243}}
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=(24e)-3&alpha;,7&alpha;,12&alpha;-trihydroxy-5&beta;-cholest-24-enoyl-coa hydratase}}
 
−
{{#set: ec-number=ec-4.2.1.107}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite GUANOSINE

  • common-name:
    • guanosine
  • smiles:
    • c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • nyhbqmygnkiuif-uuokfmhzsa-n
  • molecular-weight:
    • 283.243

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=GUANOSINE&oldid=139548"