Difference between revisions of "GUANOSINE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16322 RXN-16322] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE == * common-name: ** guanosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** nyhbqmygnkiuif-uuo...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite GUANOSINE == |
| − | * | + | * common-name: |
| − | ** | + | ** guanosine |
| − | * | + | * smiles: |
| − | ** | + | ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | == | + | * inchi-key: |
| − | * | + | ** nyhbqmygnkiuif-uuokfmhzsa-n |
| − | == | + | * molecular-weight: |
| − | * | + | ** 283.243 |
| − | * | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN0-366]] | |
| − | == | + | * [[RXN0-5199]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-7609]] |
| − | == | + | * [[RXN0-5199]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=guanosine}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=nyhbqmygnkiuif-uuokfmhzsa-n}} |
| − | + | {{#set: molecular-weight=283.243}} | |
| − | |||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GUANOSINE
- common-name:
- guanosine
- smiles:
- c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- nyhbqmygnkiuif-uuokfmhzsa-n
- molecular-weight:
- 283.243
