Difference between revisions of "GUANOSINE-5DP-3DP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14213 RXN-14213] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14213 RXN-14213] ==
+
== Metabolite GUANOSINE-5DP-3DP ==
* direction:
+
* common-name:
** left-to-right
+
** ppgpp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/3.6.1 ec-3.6.1]
+
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
== Reaction formula ==
+
* inchi-key:
* 1 [[TDP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[TMP]][c]
+
** bufllcufnheseh-uuokfmhzsa-i
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ16444]]
+
** 598.123
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[GBDP]]
== Pathway(s) ==
+
* [[PPGPPSYN-RXN]]
== Reconstruction information  ==
+
== Reaction(s) known to produce the compound ==
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GBDP]]
== External links  ==
+
* [[GDPPYPHOSKIN-RXN]]
{{#set: direction=left-to-right}}
+
== Reaction(s) of unknown directionality ==
{{#set: ec-number=ec-3.6.1}}
+
{{#set: common-name=ppgpp}}
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
{{#set: nb pathway associated=0}}
+
{{#set: molecular-weight=598.123}}
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GUANOSINE-5DP-3DP

  • common-name:
    • ppgpp
  • smiles:
    • c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • bufllcufnheseh-uuokfmhzsa-i
  • molecular-weight:
    • 598.123

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality