Difference between revisions of "GUANOSINE-5DP-3DP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSE == * common-name: ** α-d-galactose * smiles: ** c(o)c1(oc(o)c(o)c(o)c(o)1) * inchi-key: ** wqzgkkkjijffok-phyprbd...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GUANOSINE-5DP-3DP == |
* common-name: | * common-name: | ||
| − | ** | + | ** ppgpp |
* smiles: | * smiles: | ||
| − | ** c(o)c1(oc(o)c(o) | + | ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bufllcufnheseh-uuokfmhzsa-i |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 598.123 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[GBDP]] |
| − | * [[ | + | * [[PPGPPSYN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GBDP]] |
| − | + | * [[GDPPYPHOSKIN-RXN]] | |
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ppgpp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=598.123}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GUANOSINE-5DP-3DP
- common-name:
- ppgpp
- smiles:
- c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- bufllcufnheseh-uuokfmhzsa-i
- molecular-weight:
- 598.123
