Difference between revisions of "GUANOSINE-5DP-3DP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7109 == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * inchi-key: ** lwl...")
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7109 ==
+
== Metabolite GUANOSINE-5DP-3DP ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisovalerophenone
+
** ppgpp
 
* smiles:
 
* smiles:
** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
+
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 
* inchi-key:
 
* inchi-key:
** lwlgkghhvbvdkb-uhfffaoysa-m
+
** bufllcufnheseh-uuokfmhzsa-i
 
* molecular-weight:
 
* molecular-weight:
** 277.339
+
** 598.123
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7810]]
+
* [[GBDP]]
 +
* [[PPGPPSYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7811]]
+
* [[GBDP]]
 +
* [[GDPPYPHOSKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisovalerophenone}}
+
{{#set: common-name=ppgpp}}
{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
{{#set: molecular-weight=277.339}}
+
{{#set: molecular-weight=598.123}}

Latest revision as of 11:15, 18 March 2021

Metabolite GUANOSINE-5DP-3DP

  • common-name:
    • ppgpp
  • smiles:
    • c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • bufllcufnheseh-uuokfmhzsa-i
  • molecular-weight:
    • 598.123

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality