Difference between revisions of "GUANOSINE-5DP-3DP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOKIN-RXN RIBOKIN-RXN] == * direction: ** left-to-right * common-name: ** ribokinase * ec-number:...")
 
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIBOKIN-RXN RIBOKIN-RXN] ==
+
== Metabolite GUANOSINE-5DP-3DP ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** ribokinase
+
** ppgpp
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.7.1.15 ec-2.7.1.15]
+
** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
== Reaction formula ==
+
* inchi-key:
* 1 [[ATP]][c] '''+''' 1 [[CPD-10330]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[CPD-15318]][c] '''+''' 1 [[PROTON]][c]
+
** bufllcufnheseh-uuokfmhzsa-i
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ01736]]
+
** 598.123
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[GBDP]]
* Gene: [[SJ07367]]
+
* [[PPGPPSYN-RXN]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[GBDP]]
** Category: [[orthology]]
+
* [[GDPPYPHOSKIN-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ08247]]
+
{{#set: common-name=ppgpp}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=598.123}}
** Category: [[orthology]]
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
== Pathway(s) ==
 
* [[RIBOKIN-PWY]], ribose phosphorylation: [http://metacyc.org/META/NEW-IMAGE?object=RIBOKIN-PWY RIBOKIN-PWY]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13698 13698]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R01051 R01051]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P44331 P44331]
 
** [http://www.uniprot.org/uniprot/P36945 P36945]
 
** [http://www.uniprot.org/uniprot/Q57849 Q57849]
 
** [http://www.uniprot.org/uniprot/Q9CF42 Q9CF42]
 
** [http://www.uniprot.org/uniprot/P25332 P25332]
 
** [http://www.uniprot.org/uniprot/P0A9J6 P0A9J6]
 
** [http://www.uniprot.org/uniprot/O93727 O93727]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=ribokinase}}
 
{{#set: ec-number=ec-2.7.1.15}}
 
{{#set: nb gene associated=3}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology|annotation}}
 
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite GUANOSINE-5DP-3DP

  • common-name:
    • ppgpp
  • smiles:
    • c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • bufllcufnheseh-uuokfmhzsa-i
  • molecular-weight:
    • 598.123

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality