Difference between revisions of "GUANOSINE DIPHOSPHATE FUCOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8120 == * common-name: ** di-homo-γ-linolenate * smiles: ** cccccc=ccc=ccc=cccccccc(=o)[o-] * inchi-key: ** hobaelrkjckhqd-qneb...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == * common-name: ** gdp-l-fucose == Reaction(s) known to consume the compound == * RXN-15268 == Reactio...") |
||
(5 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** gdp-l-fucose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15268]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15268]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gdp-l-fucose}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite GUANOSINE_DIPHOSPHATE_FUCOSE
- common-name:
- gdp-l-fucose