Difference between revisions of "Gal-Gal-Xyl-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CDPDIACYLGLYCEROL == * common-name: ** a cdp-diacylglycerol == Reaction(s) known to consume the compound == * 2.7.8.11-RXN * PHOSPH...")
(Created page with "Category:metabolite == Metabolite CPD-15666 == * common-name: ** 2-trans,6-cis-tridecadienoyl-coa * smiles: ** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CDPDIACYLGLYCEROL ==
+
== Metabolite CPD-15666 ==
 
* common-name:
 
* common-name:
** a cdp-diacylglycerol
+
** 2-trans,6-cis-tridecadienoyl-coa
 +
* smiles:
 +
** ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** oosdlbaxvxkfib-gtubxknvsa-j
 +
* molecular-weight:
 +
** 955.803
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.8.11-RXN]]
+
* [[RXN-14772]]
* [[PHOSPHAGLYPSYN-RXN]]
 
* [[PHOSPHASERSYN-RXN]]
 
* [[RXN-8141]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CDPDIGLYSYN-RXN]]
+
* [[RXN-14771]]
* [[PHOSPHASERSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cdp-diacylglycerol}}
+
{{#set: common-name=2-trans,6-cis-tridecadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=oosdlbaxvxkfib-gtubxknvsa-j}}
 +
{{#set: molecular-weight=955.803}}

Revision as of 15:27, 5 January 2021

Metabolite CPD-15666

  • common-name:
    • 2-trans,6-cis-tridecadienoyl-coa
  • smiles:
    • ccccccc=cccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • oosdlbaxvxkfib-gtubxknvsa-j
  • molecular-weight:
    • 955.803

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality