Difference between revisions of "Gamma-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17401 == * common-name: ** 3-oxo-auricoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(...")
(Created page with "Category:metabolite == Metabolite Gamma-linolenoyl-groups == * common-name: ** a [glycerolipid]-γ-linolenate == Reaction(s) known to consume the compound == * RXN-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17401 ==
+
== Metabolite Gamma-linolenoyl-groups ==
 
* common-name:
 
* common-name:
** 3-oxo-auricoloyl-coa
+
** a [glycerolipid]-γ-linolenate
* smiles:
 
** ccc=cccc(o)cc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** fgcwebktqlbclr-jrszcninsa-j
 
* molecular-weight:
 
** 1083.973
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16154]]
+
* [[RXN-11681]]
 +
* [[RXN-16040]]
 +
* [[RXN-16043]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16153]]
+
* [[RXN-11680]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-auricoloyl-coa}}
+
{{#set: common-name=a [glycerolipid]-γ-linolenate}}
{{#set: inchi-key=inchikey=fgcwebktqlbclr-jrszcninsa-j}}
 
{{#set: molecular-weight=1083.973}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Gamma-linolenoyl-groups

  • common-name:
    • a [glycerolipid]-γ-linolenate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-γ-linolenate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.