Difference between revisions of "Gap-filling"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12116 == * common-name: ** demethylmenaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1...")
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * smiles: ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12116 ==
+
== Metabolite CPD-14602 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-6
+
** mycophenolic acid o-acyl-glucuronide
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
 
* inchi-key:
 
* inchi-key:
** ufaxpzazhzpelj-rotsudqpsa-n
+
** qbmstezxamabff-uearnrkisa-m
 
* molecular-weight:
 
* molecular-weight:
** 568.881
+
** 495.459
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9220]]
+
* [[RXN-13605]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-13607]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-6}}
+
{{#set: common-name=mycophenolic acid o-acyl-glucuronide}}
{{#set: inchi-key=inchikey=ufaxpzazhzpelj-rotsudqpsa-n}}
+
{{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}}
{{#set: molecular-weight=568.881}}
+
{{#set: molecular-weight=495.459}}

Revision as of 11:20, 15 January 2021

Metabolite CPD-14602

  • common-name:
    • mycophenolic acid o-acyl-glucuronide
  • smiles:
    • cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
  • inchi-key:
    • qbmstezxamabff-uearnrkisa-m
  • molecular-weight:
    • 495.459

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality