Difference between revisions of "Gap-filling"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite dicarboxylate == * common-name: ** a dicarboxylate == Reaction(s) known to consume the compound == * OMEGA-AMIDASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CARNITINE == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c * inchi-key: ** phiqhxfuzvpyii-zcfiwibfsa-n * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CARNITINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-carnitine |
| + | * smiles: | ||
| + | ** c(c(o)cc(=o)[o-])[n+](c)(c)c | ||
| + | * inchi-key: | ||
| + | ** phiqhxfuzvpyii-zcfiwibfsa-n | ||
| + | * molecular-weight: | ||
| + | ** 161.2 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] |
| + | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-9918]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.11.1-RXN]] |
| + | * [[CARNITINE-O-ACETYLTRANSFERASE-RXN]] | ||
| + | * [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]] | ||
| + | * [[RXN-9918]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-carnitine}} |
| + | {{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}} | ||
| + | {{#set: molecular-weight=161.2}} | ||
Revision as of 15:31, 5 January 2021
Contents
Metabolite CARNITINE
- common-name:
- l-carnitine
- smiles:
- c(c(o)cc(=o)[o-])[n+](c)(c)c
- inchi-key:
- phiqhxfuzvpyii-zcfiwibfsa-n
- molecular-weight:
- 161.2
