Difference between revisions of "Gcv-H"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8084 == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite Gcv-H == * common-name: ** [glycine cleavage system lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * ...")
 
(4 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8084 ==
+
== Metabolite Gcv-H ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:2-digalactosyldiacylglycerol
+
** [glycine cleavage system lipoyl-carrier protein]-l-lysine
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
 
* inchi-key:
 
** ohmfskzmpvonkq-ierpwchasa-n
 
* molecular-weight:
 
** 939.231
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8311]]
+
* [[RXN-13037]]
 +
* [[RXN-13039]]
 +
* [[RXN0-1141]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8310]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}}
+
{{#set: common-name=[glycine cleavage system lipoyl-carrier protein]-l-lysine}}
{{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}}
 
{{#set: molecular-weight=939.231}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Gcv-H

  • common-name:
    • [glycine cleavage system lipoyl-carrier protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "glycine cleavage system lipoyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.