Difference between revisions of "Gcv-H"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...") |
(Created page with "Category:metabolite == Metabolite Gcv-H == * common-name: ** [glycine cleavage system lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * ...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Gcv-H == |
* common-name: | * common-name: | ||
− | ** | + | ** [glycine cleavage system lipoyl-carrier protein]-l-lysine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-13037]] |
− | * [[ | + | * [[RXN-13039]] |
− | * [[ | + | * [[RXN0-1141]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=[glycine cleavage system lipoyl-carrier protein]-l-lysine}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Gcv-H
- common-name:
- [glycine cleavage system lipoyl-carrier protein]-l-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "glycine cleavage system lipoyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.