Difference between revisions of "Gcv-H"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13463 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * GLUTAMATE-SYNTHASE-FERRE...") |
(Created page with "Category:metabolite == Metabolite CPD-8084 == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8084 == |
| − | + | * common-name: | |
| − | * | + | ** 1-18:3-2-18:2-digalactosyldiacylglycerol |
| − | + | * smiles: | |
| − | * | + | ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** ohmfskzmpvonkq-ierpwchasa-n |
| − | * | + | * molecular-weight: |
| − | + | ** 939.231 | |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-8311]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | ** | + | * [[RXN-8310]] |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}} |
| − | + | {{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}} | |
| − | * [[ | + | {{#set: molecular-weight=939.231}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 20:30, 18 December 2020
Contents
Metabolite CPD-8084
- common-name:
- 1-18:3-2-18:2-digalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
- inchi-key:
- ohmfskzmpvonkq-ierpwchasa-n
- molecular-weight:
- 939.231
