Difference between revisions of "Gcv-H"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8084 == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)...")
(Created page with "Category:metabolite == Metabolite CPD-8607 == * common-name: ** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol * smiles: ** cc(c)cccc([ch]4(c1(c)(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8084 ==
+
== Metabolite CPD-8607 ==
 
* common-name:
 
* common-name:
** 1-18:3-2-18:2-digalactosyldiacylglycerol
+
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
+
** cc(c)cccc([ch]4(c1(c)(c(co)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
 
* inchi-key:
 
* inchi-key:
** ohmfskzmpvonkq-ierpwchasa-n
+
** sjpdnxkpbqhpmz-puxrvuthsa-n
 
* molecular-weight:
 
* molecular-weight:
** 939.231
+
** 444.74
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8311]]
+
* [[RXN66-12]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8310]]
+
* [[RXN66-11]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}}
+
{{#set: common-name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol}}
{{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}}
+
{{#set: inchi-key=inchikey=sjpdnxkpbqhpmz-puxrvuthsa-n}}
{{#set: molecular-weight=939.231}}
+
{{#set: molecular-weight=444.74}}

Revision as of 14:54, 5 January 2021

Metabolite CPD-8607

  • common-name:
    • 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol
  • smiles:
    • cc(c)cccc([ch]4(c1(c)(c(co)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
  • inchi-key:
    • sjpdnxkpbqhpmz-puxrvuthsa-n
  • molecular-weight:
    • 444.74

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality