Difference between revisions of "Gcv-H"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-659 == * common-name: ** l-arogenate * smiles: ** c(c(cc1(c=cc(c=c1)o)c([o-])=o)[n+])([o-])=o * inchi-key: ** mieildywganznh-dsquftab...") |
(Created page with "Category:metabolite == Metabolite BUTANAL == * common-name: ** butan-1-al * smiles: ** ccc[ch]=o * inchi-key: ** ztqsagdemfdkmz-uhfffaoysa-n * molecular-weight: ** 72.107...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BUTANAL == |
* common-name: | * common-name: | ||
| − | ** | + | ** butan-1-al |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc[ch]=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ztqsagdemfdkmz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 72.107 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BTS_LPAREN_nadph_RPAREN_]] |
| − | + | * [[RXN-161]] | |
| − | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-161]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=butan-1-al}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ztqsagdemfdkmz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=72.107}} |
Revision as of 11:13, 15 January 2021
Contents
Metabolite BUTANAL
- common-name:
- butan-1-al
- smiles:
- ccc[ch]=o
- inchi-key:
- ztqsagdemfdkmz-uhfffaoysa-n
- molecular-weight:
- 72.107
