Difference between revisions of "General-Protein-Substrates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8088 == * common-name: ** 1-linoleoyl-2-oleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop...")
(Created page with "Category:metabolite == Metabolite CPD-15163 == * common-name: ** prop-2-ynal * smiles: ** c#cc=o * inchi-key: ** ijnjlgftsiahea-uhfffaoysa-n * molecular-weight: ** 54.048...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8088 ==
+
== Metabolite CPD-15163 ==
 
* common-name:
 
* common-name:
** 1-linoleoyl-2-oleoyl-phosphatidylcholine
+
** prop-2-ynal
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** c#cc=o
 
* inchi-key:
 
* inchi-key:
** rtazwrzkfstmoy-nmsvecgzsa-n
+
** ijnjlgftsiahea-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 784.107
+
** 54.048
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8321]]
+
* [[RXN-14224]]
* [[RXN-8328]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8320]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-linoleoyl-2-oleoyl-phosphatidylcholine}}
+
{{#set: common-name=prop-2-ynal}}
{{#set: inchi-key=inchikey=rtazwrzkfstmoy-nmsvecgzsa-n}}
+
{{#set: inchi-key=inchikey=ijnjlgftsiahea-uhfffaoysa-n}}
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=54.048}}

Revision as of 13:09, 14 January 2021

Metabolite CPD-15163

  • common-name:
    • prop-2-ynal
  • smiles:
    • c#cc=o
  • inchi-key:
    • ijnjlgftsiahea-uhfffaoysa-n
  • molecular-weight:
    • 54.048

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality