Difference between revisions of "Glc2Man9GlcNAc2-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...") |
(Created page with "Category:metabolite == Metabolite Glc2Man9GlcNAc2-proteins == * common-name: ** glc2man9glcnac2-[protein] == Reaction(s) known to consume the compound == == Reaction(s) kn...") |
||
| (6 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glc2Man9GlcNAc2-proteins == |
* common-name: | * common-name: | ||
| − | ** | + | ** glc2man9glcnac2-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.2.1.106-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glc2man9glcnac2-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite Glc2Man9GlcNAc2-proteins
- common-name:
- glc2man9glcnac2-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "glc2man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
