|
|
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12726 RXN-12726] == | + | == Metabolite SULFO-CYSTEINE == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** selenocysteine synthase | + | ** s-sulfo-l-cysteine |
| − | ** cysteine synthase
| + | * smiles: |
| − | * ec-number: | + | ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o |
| − | ** [http://enzyme.expasy.org/EC/2.5.1.47 ec-2.5.1.47] | + | * inchi-key: |
| − | == Reaction formula ==
| + | ** nokpbjyhphhwan-reohclbhsa-m |
| − | * 1 [[ACETYLSERINE]][c] '''+''' 1 [[CPD-678]][c] '''=>''' 1 [[ACET]][c] '''+''' 1 [[L-SELENOCYSTEINE]][c] '''+''' 1 [[PROTON]][c]
| + | * molecular-weight: |
| − | == Gene(s) associated with this reaction ==
| + | ** 200.204 |
| − | * Gene: [[SJ15937]] | + | == Reaction(s) known to consume the compound == |
| − | ** Category: [[annotation]] | + | * [[SULFOCYS-RXN]] |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | * Gene: [[SJ16706]]
| + | * [[SULFOCYS-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| + | {{#set: common-name=s-sulfo-l-cysteine}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: molecular-weight=200.204}} |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ01657]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | == Pathway(s) == | |
| − | * [[PWY-6936]], seleno-amino acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936] | |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: common-name=selenocysteine synthase|cysteine synthase}}
| |
| − | {{#set: ec-number=ec-2.5.1.47}} | |
| − | {{#set: nb gene associated=3}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_nannochloropsis_salina|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
| |
