Difference between revisions of "Glc2Man9GlcNAc2-proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...")
(Created page with "Category:metabolite == Metabolite CPD-14447 == * common-name: ** (2z)-2-hydroxypenta-2,4-dienoate * smiles: ** c=cc=c(c([o-])=o)o * inchi-key: ** vhtqqdxpnutmnb-arjawskdsa...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SULFO-CYSTEINE ==
+
== Metabolite CPD-14447 ==
 
* common-name:
 
* common-name:
** s-sulfo-l-cysteine
+
** (2z)-2-hydroxypenta-2,4-dienoate
 
* smiles:
 
* smiles:
** c(c([n+])c(=o)[o-])ss([o-])(=o)=o
+
** c=cc=c(c([o-])=o)o
 
* inchi-key:
 
* inchi-key:
** nokpbjyhphhwan-reohclbhsa-m
+
** vhtqqdxpnutmnb-arjawskdsa-m
 
* molecular-weight:
 
* molecular-weight:
** 200.204
+
** 113.093
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SULFOCYS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[SULFOCYS-RXN]]
+
* [[MHPCHYDROL-RXN]]
 +
* [[RXN-12070]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfo-l-cysteine}}
+
{{#set: common-name=(2z)-2-hydroxypenta-2,4-dienoate}}
{{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}}
+
{{#set: inchi-key=inchikey=vhtqqdxpnutmnb-arjawskdsa-m}}
{{#set: molecular-weight=200.204}}
+
{{#set: molecular-weight=113.093}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-14447

  • common-name:
    • (2z)-2-hydroxypenta-2,4-dienoate
  • smiles:
    • c=cc=c(c([o-])=o)o
  • inchi-key:
    • vhtqqdxpnutmnb-arjawskdsa-m
  • molecular-weight:
    • 113.093

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality