Difference between revisions of "Glc2Man9GlcNAc2-proteins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...") |
(Created page with "Category:metabolite == Metabolite CPD-14447 == * common-name: ** (2z)-2-hydroxypenta-2,4-dienoate * smiles: ** c=cc=c(c([o-])=o)o * inchi-key: ** vhtqqdxpnutmnb-arjawskdsa...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-14447 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z)-2-hydroxypenta-2,4-dienoate |
* smiles: | * smiles: | ||
− | ** c | + | ** c=cc=c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vhtqqdxpnutmnb-arjawskdsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 113.093 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MHPCHYDROL-RXN]] |
+ | * [[RXN-12070]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z)-2-hydroxypenta-2,4-dienoate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vhtqqdxpnutmnb-arjawskdsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=113.093}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-14447
- common-name:
- (2z)-2-hydroxypenta-2,4-dienoate
- smiles:
- c=cc=c(c([o-])=o)o
- inchi-key:
- vhtqqdxpnutmnb-arjawskdsa-m
- molecular-weight:
- 113.093