Difference between revisions of "GlcA-Gal-Gal-Xyl-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...")
(Created page with "Category:metabolite == Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA == * common-name: ** rnase ii poly-a substrate mrna == Reaction(s) known to consume the compound == * RX...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12321 ==
+
== Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA ==
 
* common-name:
 
* common-name:
** 15-cis-phytoene
+
** rnase ii poly-a substrate mrna
* smiles:
 
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c
 
* inchi-key:
 
** yvlpjigomtxxlp-bhljudrvsa-n
 
* molecular-weight:
 
** 544.946
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11355]]
+
* [[RXN0-6524]]
* [[RXN-12243]]
 
* [[RXN-12413]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13323]]
 
* [[RXNARA-8002]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15-cis-phytoene}}
+
{{#set: common-name=rnase ii poly-a substrate mrna}}
{{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}}
 
{{#set: molecular-weight=544.946}}
 

Revision as of 08:31, 15 March 2021

Metabolite RNASE-II-POLY-A-SUBSTRATE-MRNA

  • common-name:
    • rnase ii poly-a substrate mrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality