Difference between revisions of "GlcA-Gal-Gal-Xyl-Proteins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CAAX-proteins == * common-name: ** a protein that ends with a caax sequence == Reaction(s) known to consume the compound == * RXN-17573...")
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common-name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CAAX-proteins ==
+
== Metabolite CPD-17346 ==
 
* common-name:
 
* common-name:
** a protein that ends with a caax sequence
+
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
 +
* smiles:
 +
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** puwduocpcwfefg-ygyqdceasa-j
 +
* molecular-weight:
 +
** 1067.974
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17573]]
+
* [[RXN-16095]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16094]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a protein that ends with a caax sequence}}
+
{{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
 +
{{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
 +
{{#set: molecular-weight=1067.974}}

Revision as of 15:30, 5 January 2021

Metabolite CPD-17346

  • common-name:
    • 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • puwduocpcwfefg-ygyqdceasa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality