Difference between revisions of "GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INDOXYL == * common-name: ** indoxyl * smiles: ** c2(c=cc1(=c(c(o)=cn1)c=2)) * inchi-key: ** pckpvgolpkluhr-uhfffaoysa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite Sphingoids == * common-name: ** a sphingoid base == Reaction(s) known to consume the compound == * RXN-11376 * SPHINGOSINE-N-ACYLTR...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Sphingoids == |
* common-name: | * common-name: | ||
− | ** | + | ** a sphingoid base |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-11376]] |
+ | * [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[SPHINGOSINE-N-ACYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a sphingoid base}} |
− | |||
− |
Revision as of 18:56, 14 January 2021
Contents
Metabolite Sphingoids
- common-name:
- a sphingoid base