Difference between revisions of "GlcNAc-GlcA-Gal-Gal-Xyl-Protein"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-294 == * common-name: ** 2-maleylacetate * smiles: ** c(=cc(=o)[o-])c(=o)cc([o-])=o * inchi-key: ** soxxpqlizipmiz-uphrsurjsa-l * mol...") |
(Created page with "Category:metabolite == Metabolite GlcNAc-GlcA-Gal-Gal-Xyl-Protein == * common-name: ** a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite GlcNAc-GlcA-Gal-Gal-Xyl-Protein == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[2.4.1.225-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.4.1.223-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite GlcNAc-GlcA-Gal-Gal-Xyl-Protein
- common-name:
- a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
