Difference between revisions of "GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...")
(Created page with "Category:metabolite == Metabolite GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core == * common-name: ** a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-&alph...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-TRYPTOPHAN ==
+
== Metabolite GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core ==
 
* common-name:
 
* common-name:
** d-tryptophan
+
** a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine
* smiles:
 
** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2))
 
* inchi-key:
 
** qivbcdijiajpqs-secbinfhsa-n
 
* molecular-weight:
 
** 204.228
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8664]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.4.1.224-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-tryptophan}}
+
{{#set: common-name=a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine}}
{{#set: inchi-key=inchikey=qivbcdijiajpqs-secbinfhsa-n}}
 
{{#set: molecular-weight=204.228}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite GlcNAc-GlcA-GlcNAc-GlcA-Gal-Gal-Xyl-Core

  • common-name:
    • a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-3-o-(α-d-glcnac-(1→4)-β-d-glca-(1→3)-α-d-glcnac-(1→4)-β-d-glca-(1→3)-β-d-gal-(1→3)-β-d-gal-(1→4)-β-d-xyl)-l-serine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.