Difference between revisions of "Glucopyranose"

Latest revision as of 11:11, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite MALTOHEXAOSE ==
+== Metabolite Glucopyranose ==
 * common-name:
-** maltohexaose
+** d-glucopyranose
-* smiles:
-** c(c6(oc(oc5(c(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c5o)o)co))c(c(c6o)o)o))o
-* inchi-key:
-** ocibbxpluvykch-liggpisvsa-n
-* molecular-weight:
-** 990.867
 == Reaction(s) known to consume the compound ==
+* [[GLUCISOM-RXN]]
+* [[GLUCOKIN-RXN]]
+* [[LACTOSE-SYNTHASE-RXN]]
+== Reaction(s) known to produce the compound ==
+<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+* [[2.3.1.91-RXN]]
+* [[3.2.1.21-RXN]]
+* [[3.2.1.39-RXN]]
+* [[3.2.1.84-RXN]]
+* [[ALPHAGALACTOSID-RXN]]
+* [[BETAGALACTOSID-RXN]]
+* [[GLUCISOM-RXN]]
+* [[GLUCOSYLCERAMIDASE-RXN]]
+* [[KETOLACTOSE-RXN]]
+* [[MALTODEXGLUCOSID-RXN]]
+* [[RXN-10769]]
+* [[RXN-10773]]
+* [[RXN-13600]]
+* [[RXN-13602]]
+* [[RXN-13603]]
+* [[RXN-14179]]
+* [[RXN-14281]]
 * [[RXN-14282]]
-* [[RXN-14285]]
-== Reaction(s) known to produce the compound ==
 * [[RXN-14283]]
-* [[RXN-14286]]
+* [[RXN-15910]]
-* [[RXN0-5181]]
+* [[RXN-5341]]
+* [[RXN-8036]]
+* [[RXN-9674]]
+* [[RXN0-5183]]
+* [[RXN0-5395]]
+* [[RXN66-526]]
+</div>
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=maltohexaose}}
+{{#set: common-name=d-glucopyranose}}
-{{#set: inchi-key=inchikey=ocibbxpluvykch-liggpisvsa-n}}
-{{#set: molecular-weight=990.867}}