Difference between revisions of "Glucose"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-465 == * common-name: ** presqualene diphosphate * smiles: ** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-]...")
(Created page with "Category:metabolite == Metabolite Glucose == * common-name: ** glucose == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * ...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-465 ==
+
== Metabolite Glucose ==
 
* common-name:
 
* common-name:
** presqualene diphosphate
+
** glucose
* smiles:
 
** cc(=cccc(=cccc(=cc1(c(c)(ccc=c(ccc=c(c)c)c)c1cop(op([o-])([o-])=o)([o-])=o))c)c)c
 
* inchi-key:
 
** atzkauggnmsccy-qlydttawsa-k
 
* molecular-weight:
 
** 583.66
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13724]]
 
* [[RXN66-281]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12263]]
+
* [[3.2.1.1-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=presqualene diphosphate}}
+
{{#set: common-name=glucose}}
{{#set: inchi-key=inchikey=atzkauggnmsccy-qlydttawsa-k}}
 
{{#set: molecular-weight=583.66}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Glucose

  • common-name:
    • glucose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality