Difference between revisions of "Glucosyl-acyl-sphingosines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) * inchi-key: ** focuaj...") |
(Created page with "Category:metabolite == Metabolite Single-Stranded-DNAs == * common-name: ** a single stranded dna == Reaction(s) known to consume the compound == * RXN0-5021 == Reacti...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Single-Stranded-DNAs == |
* common-name: | * common-name: | ||
− | ** | + | ** a single stranded dna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN0-5021]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-4261]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a single stranded dna}} |
− | |||
− |
Revision as of 18:58, 14 January 2021
Contents
Metabolite Single-Stranded-DNAs
- common-name:
- a single stranded dna