Difference between revisions of "Glucosyl-acyl-sphingosines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key...") |
(Created page with "Category:metabolite == Metabolite Glucosyl-acyl-sphingosines == * common-name: ** a β-d-glucosyl-n-acylsphingosine == Reaction(s) known to consume the compound == * [...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Glucosyl-acyl-sphingosines == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-d-glucosyl-n-acylsphingosine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[GLUCOSYLCERAMIDASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-d-glucosyl-n-acylsphingosine}} |
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite Glucosyl-acyl-sphingosines
- common-name:
- a β-d-glucosyl-n-acylsphingosine
