Difference between revisions of "Glucosyl-acyl-sphingosines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8014 RXN-8014] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite DITP == * common-name: ** ditp * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-key...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8014 RXN-8014] ==
+
== Metabolite DITP ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** ditp
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.2.1 ec-1.2.1]
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[NADP]][c] '''+''' 1 [[SINAPALDEHYDE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[NADPH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[SINAPATE]][c]
+
** ufjpaqslhagebl-rrkcrqdmsa-j
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05897]]
+
** 488.137
−
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-14228]]
−
== Pathway(s) ==
+
* [[RXN0-1602]]
−
* [[PWY-5168]], ferulate and sinapate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5168 PWY-5168]
+
== Reaction(s) known to produce the compound ==
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
* [[RXN-14228]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=ditp}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}}
−
* LIGAND-RXN:
+
{{#set: molecular-weight=488.137}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R07442 R07442]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.2.1}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:36, 18 December 2020

Metabolite DITP

  • common-name:
    • ditp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • inchi-key:
    • ufjpaqslhagebl-rrkcrqdmsa-j
  • molecular-weight:
    • 488.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Glucosyl-acyl-sphingosines&oldid=48053"