Difference between revisions of "Glucuronosylated-Glucuronoside-Acceptors"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-30 == * common-name: ** 4-acetamidobutanal * smiles: ** cc(nccc[ch]=o)=o * inchi-key: ** ddslgzoyepkpsj-uhfffaoysa-n * molecular-weig...") |
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * common-name: ** d-threo-isocitrate * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * inchi-key: ** odblhexud...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THREO-DS-ISO-CITRATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-threo-isocitrate |
* smiles: | * smiles: | ||
| − | ** cc( | + | ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** odblhexudapzau-zafykaaxsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 189.101 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[ACONITATEHYDR-RXN]] |
| + | * [[ISOCIT-CLEAV-RXN]] | ||
| + | * [[ISOCITDEH-RXN]] | ||
| + | * [[RXN-14047]] | ||
| + | * [[RXN-9951]] | ||
| + | * [[biomass_rxn]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[ACONITATEHYDR-RXN]] |
| + | * [[ISOCIT-CLEAV-RXN]] | ||
| + | * [[ISOCITDEH-RXN]] | ||
| + | * [[RXN-14047]] | ||
| + | * [[RXN-9951]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-threo-isocitrate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=189.101}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite THREO-DS-ISO-CITRATE
- common-name:
- d-threo-isocitrate
- smiles:
- c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
- inchi-key:
- odblhexudapzau-zafykaaxsa-k
- molecular-weight:
- 189.101
