Difference between revisions of "Glutamine-synthetase-adenylyl-Tyr"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE == * common-name: ** d-myo-inositol (3,4)-bisphosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(...")
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-adenylyl-Tyr == * common-name: ** a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine == Reaction(s) known to consu...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite D-MYO-INOSITOL-34-BISPHOSPHATE ==
+
== Metabolite Glutamine-synthetase-adenylyl-Tyr ==
 
* common-name:
 
* common-name:
** d-myo-inositol (3,4)-bisphosphate
+
** a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine
* smiles:
 
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)1)
 
* inchi-key:
 
** mckajxmrulsuki-cnwjwelysa-j
 
* molecular-weight:
 
** 336.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10960]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10939]]
+
* [[GSADENYLATION-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (3,4)-bisphosphate}}
+
{{#set: common-name=a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine}}
{{#set: inchi-key=inchikey=mckajxmrulsuki-cnwjwelysa-j}}
 
{{#set: molecular-weight=336.085}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite Glutamine-synthetase-adenylyl-Tyr

  • common-name:
    • a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.