Difference between revisions of "Glycerolipid-crepenynate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINATE_NUCLEOTIDE == * common-name: ** β-nicotinate d-ribonucleotide * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=...")
(Created page with "Category:metabolite == Metabolite Glycerolipid-crepenynate == * common-name: ** a [glycerolipid]-crepenynate == Reaction(s) known to consume the compound == == Reaction(s)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NICOTINATE_NUCLEOTIDE ==
+
== Metabolite Glycerolipid-crepenynate ==
 
* common-name:
 
* common-name:
** β-nicotinate d-ribonucleotide
+
** a [glycerolipid]-crepenynate
* smiles:
 
** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
 
* inchi-key:
 
** jouiqrnqjgxqdc-zyuzmqfosa-l
 
* molecular-weight:
 
** 333.191
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[NICONUCADENYLYLTRAN-RXN]]
 
* [[RXN-14227]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
+
* [[1.14.99.33-RXN]]
* [[QUINOPRIBOTRANS-RXN]]
 
* [[RXN-8443]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-nicotinate d-ribonucleotide}}
+
{{#set: common-name=a [glycerolipid]-crepenynate}}
{{#set: inchi-key=inchikey=jouiqrnqjgxqdc-zyuzmqfosa-l}}
 
{{#set: molecular-weight=333.191}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Glycerolipid-crepenynate

  • common-name:
    • a [glycerolipid]-crepenynate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-crepenynate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.