Difference between revisions of "Glycerolipids"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10943 == * transcription-direction: ** positive * right-end-position: ** 46693 * left-end-position: ** 27208 * centisome-position: ** 7.1403265...")
(Created page with "Category:metabolite == Metabolite CPD-14424 == * common-name: ** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ10943 ==
+
== Metabolite CPD-14424 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 46693
+
** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 27208
+
** kidydclnvxonef-pybsmvoosa-j
−
* centisome-position:
+
* molecular-weight:
−
** 7.1403265   
+
** 1091.996
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13444]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.7.10.1-RXN]]
+
* [[RXN-13443]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa}}
−
* [[2.7.12.1-RXN]]
+
{{#set: inchi-key=inchikey=kidydclnvxonef-pybsmvoosa-j}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=1091.996}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[PROTEIN-KINASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14906]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8443]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5381]]
 
−
** '''6''' reactions found over '''11''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=46693}}
 
−
{{#set: left-end-position=27208}}
 
−
{{#set: centisome-position=7.1403265    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-14424

  • common-name:
    • (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kidydclnvxonef-pybsmvoosa-j
  • molecular-weight:
    • 1091.996

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Glycerolipids&oldid=45894"