Difference between revisions of "Glycerophosphodiesters"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL == * common-name: ** 2-carboxy-d-arabinitol * smiles: ** c(c(c(c(c([o-])=o)(co)o)o)o)o * inchi-key: ** xondrgralzt...")
(Created page with "Category:metabolite == Metabolite Glycerophosphodiesters == * common-name: ** a glycerophosphodiester == Reaction(s) known to consume the compound == * [[GLYCPDIESTER-RXN]...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-CARBOXY-D-ARABINITOL ==
+
== Metabolite Glycerophosphodiesters ==
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol
+
** a glycerophosphodiester
* smiles:
 
** c(c(c(c(c([o-])=o)(co)o)o)o)o
 
* inchi-key:
 
** xondrgralztvkd-zmizwqjlsa-m
 
* molecular-weight:
 
** 195.149
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCPDIESTER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-d-arabinitol}}
+
{{#set: common-name=a glycerophosphodiester}}
{{#set: inchi-key=inchikey=xondrgralztvkd-zmizwqjlsa-m}}
 
{{#set: molecular-weight=195.149}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite Glycerophosphodiesters

  • common-name:
    • a glycerophosphodiester

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality