Difference between revisions of "Guanine10-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite A-5-prime-PP-5-prime-DNA == * common-name: ** an adenosine-5'-diphospho-5'-[dna] == Reaction(s) known to consume the compound == * RXN-...") |
(Created page with "Category:metabolite == Metabolite DEOXYXYLULOSE-5P == * common-name: ** 1-deoxy-d-xylulose 5-phosphate * smiles: ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] * inchi-key: ** ajpadpz...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DEOXYXYLULOSE-5P == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-deoxy-d-xylulose 5-phosphate |
| + | * smiles: | ||
| + | ** cc(=o)c(o)c(o)cop([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** ajpadpzsrrughi-rfzpgflssa-l | ||
| + | * molecular-weight: | ||
| + | ** 212.096 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DXPREDISOM-RXN]] |
| + | * [[THIAZOLSYN2-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[DXPREDISOM-RXN]] |
| + | * [[DXS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-deoxy-d-xylulose 5-phosphate}} |
| + | {{#set: inchi-key=inchikey=ajpadpzsrrughi-rfzpgflssa-l}} | ||
| + | {{#set: molecular-weight=212.096}} | ||
Revision as of 08:26, 15 March 2021
Contents
Metabolite DEOXYXYLULOSE-5P
- common-name:
- 1-deoxy-d-xylulose 5-phosphate
- smiles:
- cc(=o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- ajpadpzsrrughi-rfzpgflssa-l
- molecular-weight:
- 212.096
