Difference between revisions of "Guanine10-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1o)=o)o)o) * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-...") |
(Created page with "Category:metabolite == Metabolite Guanine10-in-tRNA == * common-name: ** a guanine10 in trna == Reaction(s) known to consume the compound == * RXN-12374 == Reaction(s)...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Guanine10-in-tRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** a guanine10 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12374]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a guanine10 in trna}} |
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite Guanine10-in-tRNA
- common-name:
- a guanine10 in trna