Difference between revisions of "Guanine10-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Oxidized-cytochromes-c551 == * common-name: ** an oxidized cytochrome c551 == Reaction(s) known to consume the compound == * [[RXN-15838]...") |
(Created page with "Category:metabolite == Metabolite CPD-1242 == * common-name: ** 3-keto-β-d-galactose * smiles: ** c(o)c1(oc(c(c(c1o)=o)o)o) * inchi-key: ** apiqnbnbiiccon-fkmsrsahsa-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1242 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-keto-β-d-galactose |
| + | * smiles: | ||
| + | ** c(o)c1(oc(c(c(c1o)=o)o)o) | ||
| + | * inchi-key: | ||
| + | ** apiqnbnbiiccon-fkmsrsahsa-n | ||
| + | * molecular-weight: | ||
| + | ** 178.141 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[KETOLACTOSE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-keto-β-d-galactose}} |
| + | {{#set: inchi-key=inchikey=apiqnbnbiiccon-fkmsrsahsa-n}} | ||
| + | {{#set: molecular-weight=178.141}} | ||
Revision as of 18:54, 14 January 2021
Contents
Metabolite CPD-1242
- common-name:
- 3-keto-β-d-galactose
- smiles:
- c(o)c1(oc(c(c(c1o)=o)o)o)
- inchi-key:
- apiqnbnbiiccon-fkmsrsahsa-n
- molecular-weight:
- 178.141
