Difference between revisions of "Guanine1575-in-18StRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE == * common-name: ** 2-carboxy-d-arabinitol 1-phosphate * smiles: ** c(c(c(c(cop([o-])([o-])=o)(c([o...")
(Created page with "Category:metabolite == Metabolite Guanine1575-in-18StRNAs == * common-name: ** a guanine1575 in 18s trna == Reaction(s) known to consume the compound == * RXN-15842 ==...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE ==
+
== Metabolite Guanine1575-in-18StRNAs ==
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol 1-phosphate
+
** a guanine1575 in 18s trna
* smiles:
 
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
 
* inchi-key:
 
** ujtmirnfexkgms-uhfffaoysa-k
 
* molecular-weight:
 
** 273.113
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+
* [[RXN-15842]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
+
{{#set: common-name=a guanine1575 in 18s trna}}
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
 
{{#set: molecular-weight=273.113}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Guanine1575-in-18StRNAs

  • common-name:
    • a guanine1575 in 18s trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality