Difference between revisions of "Guanine26-in-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * smiles: ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Guanine26-in-tRNA == * common-name: ** a guanine26 in trna == Reaction(s) known to consume the compound == * RXN-12375 * [[RXN-12377]...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Guanine26-in-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** a guanine26 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12375]] | ||
| + | * [[RXN-12377]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a guanine26 in trna}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Guanine26-in-tRNA
- common-name:
- a guanine26 in trna
